CAS 40359-30-6 appears in our catalog under these names: 2-(2-Formyl-6-methoxyphenoxy)acetic acid, 2-(2-Formyl-6-methoxyphenoxy)acetic acid, 95%, 2-(2-Formyl-6-methoxyphenoxy)acetic acid 95%, 2-(2-Formyl-6-methoxyphenoxy)acetic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
2-(2-formyl-6-methoxyphenoxy)acetic acid (CAS 40359-30-6) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-(2-formyl-6-methoxyphenoxy)acetic acid. InChIKey: STGBYWNNAZDMFE-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 2-(2-formyl-6-methoxyphenoxy)acetic acid |
| InChIKey | STGBYWNNAZDMFE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1OCC(=O)O)C=O |
Computed by PubChem (NCBI)