CAS 4044-60-4 appears in our catalog under these names: (2,5-Dimethylphenyl)(phenyl)methanone, 95%, (2,5-Dimethylphenyl)(phenyl)methanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(3,5-dimethylphenyl)-phenylmethanone (CAS 4044-60-4) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: (3,5-dimethylphenyl)-phenylmethanone. InChIKey: OLXZWWMXQRMOGP-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | (3,5-dimethylphenyl)-phenylmethanone |
| InChIKey | OLXZWWMXQRMOGP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)