CAS 4044-98-8 appears in our catalog under these names: 6–Bromo–2–phenylimidazo(1,2–a)pyridine, 6-Bromo-2-phenylimidazo[1,2-a]pyridine 97%, 6-Bromo-2-phenylimidazo[1,2-a]pyridine, 97%, 97%, 6-Bromo-2-phenylimidazo[1,2-a]pyridine. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 25g, 1g, 100g.
6-bromo-2-phenylimidazo[1,2-a]pyridine (CAS 4044-98-8) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 6-bromo-2-phenylimidazo[1,2-a]pyridine. InChIKey: JECUQJPFGTUNCJ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 6-bromo-2-phenylimidazo[1,2-a]pyridine |
| InChIKey | JECUQJPFGTUNCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=C(C=CC3=N2)Br |
Computed by PubChem (NCBI)