CAS 404827-79-8 is the registry number for 4-(1H-Pyrrol-1-yl)-1H-indazol-3-amine. Offered by: TRC. Available pack sizes: 500mg.
4-pyrrol-1-yl-1H-indazol-3-amine (CAS 404827-79-8) is a chemical compound with the molecular formula C11H10N4 and a molecular weight of 198.22 g/mol. IUPAC name: 4-pyrrol-1-yl-1H-indazol-3-amine. InChIKey: AOALORIJOUUMIN-UHFFFAOYSA-N.
| Molecular formula | C11H10N4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 4-pyrrol-1-yl-1H-indazol-3-amine |
| InChIKey | AOALORIJOUUMIN-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=CC3=C2C(=NN3)N |
Computed by PubChem (NCBI)