CAS 404839-31-2 is the registry number for 4-Methyl-N-(methyl-13C)benzenesulfonamide. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
4-methyl-N-(113C)methylbenzenesulfonamide (CAS 404839-31-2) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 186.24 g/mol. IUPAC name: 4-methyl-N-(113C)methylbenzenesulfonamide. InChIKey: GWLOGZRVYXAHRE-VQEHIDDOSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 186.24 g/mol |
| IUPAC name | 4-methyl-N-(113C)methylbenzenesulfonamide |
| InChIKey | GWLOGZRVYXAHRE-VQEHIDDOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[13CH3] |
Computed by PubChem (NCBI)