Products 405111-47-9

CAS 405111-47-9 is the registry number for 2-(1-Hydroxyethyl)nicotinic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(1-hydroxyethyl)pyridine-3-carboxylic acid (CAS 405111-47-9) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-(1-hydroxyethyl)pyridine-3-carboxylic acid. InChIKey: VTNMPYLZOCKDOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO3
Molecular weight167.16 g/mol
IUPAC name2-(1-hydroxyethyl)pyridine-3-carboxylic acid
InChIKeyVTNMPYLZOCKDOJ-UHFFFAOYSA-N
SMILESCC(C1=C(C=CC=N1)C(=O)O)O

Computed by PubChem (NCBI)