CAS 405150-20-1 appears in our catalog under these names: (R)-2-Amino-3-(thiazol-2-ylthio)propanoic acid, 97%, S-(2-Thiazolyl)-L-Cysteine, S-2-Thiazolyl-L-cysteine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2R)-2-amino-3-(1,3-thiazol-2-ylsulfanyl)propanoic acid (CAS 405150-20-1) is a chemical compound with the molecular formula C6H8N2O2S2 and a molecular weight of 204.3 g/mol. IUPAC name: (2R)-2-amino-3-(1,3-thiazol-2-ylsulfanyl)propanoic acid. InChIKey: ULBLKXPBISVARU-BYPYZUCNSA-N.
| Molecular formula | C6H8N2O2S2 |
|---|---|
| Molecular weight | 204.3 g/mol |
| IUPAC name | (2R)-2-amino-3-(1,3-thiazol-2-ylsulfanyl)propanoic acid |
| InChIKey | ULBLKXPBISVARU-BYPYZUCNSA-N |
| SMILES | C1=CSC(=N1)SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)