Products 436091-42-8

CAS 436091-42-8 is the registry number for 2-((5-Methyl-1,3,4-thiadiazol-2-yl)thio)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid (CAS 436091-42-8) is a chemical compound with the molecular formula C6H8N2O2S2 and a molecular weight of 204.3 g/mol. IUPAC name: 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid. InChIKey: GLGPJFLSHUJPNM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O2S2
Molecular weight204.3 g/mol
IUPAC name2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid
InChIKeyGLGPJFLSHUJPNM-UHFFFAOYSA-N
SMILESCC1=NN=C(S1)SC(C)C(=O)O

Computed by PubChem (NCBI)