Products 869943-40-8

CAS 869943-40-8 is the registry number for 3-[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid (CAS 869943-40-8) is a chemical compound with the molecular formula C6H8N2O2S2 and a molecular weight of 204.3 g/mol. IUPAC name: 3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid. InChIKey: BZEBUBGIZUJFKS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O2S2
Molecular weight204.3 g/mol
IUPAC name3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid
InChIKeyBZEBUBGIZUJFKS-UHFFFAOYSA-N
SMILESCC1=NN=C(S1)SCCC(=O)O

Computed by PubChem (NCBI)