CAS 405230-79-7 appears in our catalog under these names: 2–Chloro–5–fluoropyridine 1–oxide, 2-Chloro-5-fluoropyridine 1-oxide 97%, 2-Chloro-5-fluoropyridine 1-oxide, 97%, 97%, Pyridine, 2-chloro-5-fluoro-, 1-oxide (9CI), 97%(LC-MS),RG. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
2-chloro-5-fluoro-1-oxidopyridin-1-ium (CAS 405230-79-7) is a chemical compound with the molecular formula C5H3ClFNO and a molecular weight of 147.53 g/mol. IUPAC name: 2-chloro-5-fluoro-1-oxidopyridin-1-ium. InChIKey: FOAJNTAVEGJKON-UHFFFAOYSA-N.
| Molecular formula | C5H3ClFNO |
|---|---|
| Molecular weight | 147.53 g/mol |
| IUPAC name | 2-chloro-5-fluoro-1-oxidopyridin-1-ium |
| InChIKey | FOAJNTAVEGJKON-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1F)[O-])Cl |
Computed by PubChem (NCBI)