CAS 405278-63-9 appears in our catalog under these names: 2-(1H-Pyrazole-3-amido)benzoic acid, 95%, 2-(1H-Pyrazole-3-amido)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(1H-pyrazole-5-carbonylamino)benzoic acid (CAS 405278-63-9) is a chemical compound with the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. IUPAC name: 2-(1H-pyrazole-5-carbonylamino)benzoic acid. InChIKey: HLSFGRIYROGCTO-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O3 |
|---|---|
| Molecular weight | 231.21 g/mol |
| IUPAC name | 2-(1H-pyrazole-5-carbonylamino)benzoic acid |
| InChIKey | HLSFGRIYROGCTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CC=NN2 |
Computed by PubChem (NCBI)