CAS 405279-59-6 appears in our catalog under these names: 3-(Benzo[1,2,5]thiadiazole-4-sulfonylamino)-propionic acid, 95%, 3-(Benzo(1,2,5)thiadiazole-4-sulfonylamino)-propionic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoic acid (CAS 405279-59-6) is a chemical compound with the molecular formula C9H9N3O4S2 and a molecular weight of 287.3 g/mol. IUPAC name: 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoic acid. InChIKey: MRJJNXSJOOEQAA-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O4S2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)propanoic acid |
| InChIKey | MRJJNXSJOOEQAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C(=C1)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)