CAS 952959-27-2 appears in our catalog under these names: 4-[(5-Amino-1,3,4-thiadiazol-2-yl)methoxy]benzenesulfonic acid, 95%, 4-((5-Amino-1,3,4-thiadiazol-2-yl)methoxy)benzenesulfonic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 10g, 5g.
4-[(5-amino-1,3,4-thiadiazol-2-yl)methoxy]benzenesulfonic acid (CAS 952959-27-2) is a chemical compound with the molecular formula C9H9N3O4S2 and a molecular weight of 287.3 g/mol. IUPAC name: 4-[(5-amino-1,3,4-thiadiazol-2-yl)methoxy]benzenesulfonic acid. InChIKey: BRKKWRQBGKCIRW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O4S2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)methoxy]benzenesulfonic acid |
| InChIKey | BRKKWRQBGKCIRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC2=NN=C(S2)N)S(=O)(=O)O |
Computed by PubChem (NCBI)