Products 882268-69-1
CAS 882268-69-1 appears in our catalog under these names: HIF-2α-IN-4, 98%, HIF-2α-IN-4, HIF–2α–IN–4, HIF-2± Translation Inhibitor, HIF-2α-IN-4 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 100mg, 200mg, 0,5g, 250mg.
Methyl 3-[(2E)-2-[cyano(methylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate (CAS 882268-69-1) is a chemical compound with the molecular formula C9H9N3O4S2 and a molecular weight of 287.3 g/mol. IUPAC name: methyl 3-[(2E)-2-[cyano(methylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate. InChIKey: OOGAPDPPVHJYGJ-KPKJPENVSA-N.
| Molecular formula | C9H9N3O4S2 |
|---|---|
| Molecular weight | 287.3 g/mol |
| IUPAC name | methyl 3-[(2E)-2-[cyano(methylsulfonyl)methylidene]hydrazinyl]thiophene-2-carboxylate |
| InChIKey | OOGAPDPPVHJYGJ-KPKJPENVSA-N |
| SMILES | COC(=O)C1=C(C=CS1)N/N=C(\C#N)/S(=O)(=O)C |
Computed by PubChem (NCBI)