CAS 4053-34-3 appears in our catalog under these names: 6–Methylquinolin–2(1H)–one, 6-Methylquinolin-2(1H)-one 98%, 6-Methylquinolin-2(1H)-one, 98%, 98%, 6-Methylquinolin-2-ol, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 25g.
6-methyl-1H-quinolin-2-one (CAS 4053-34-3) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-methyl-1H-quinolin-2-one. InChIKey: LOUXUHOSYWFSHV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 6-methyl-1H-quinolin-2-one |
| InChIKey | LOUXUHOSYWFSHV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC(=O)C=C2 |
Computed by PubChem (NCBI)