CAS 4053-35-4 appears in our catalog under these names: 7-Methylquinolin-2(1H)-one, 97%, 7-Methyl-1,2-dihydroquinolin-2-one, 7-Methylquinolin-2(1H)-one 97%, 7-methyl-1,2-dihydroquinolin-2-one, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
7-methyl-1H-quinolin-2-one (CAS 4053-35-4) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 7-methyl-1H-quinolin-2-one. InChIKey: QLVPBCMPYVAWEW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 7-methyl-1H-quinolin-2-one |
| InChIKey | QLVPBCMPYVAWEW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC(=O)N2 |
Computed by PubChem (NCBI)