Products 40567-55-3
CAS 40567-55-3 is the registry number for 5-Amino-6-bromo-2-butyl-1H-isoindole-1,3(2H)-dione, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-amino-6-bromo-2-butylisoindole-1,3-dione (CAS 40567-55-3) is a chemical compound with the molecular formula C12H13BrN2O2 and a molecular weight of 297.15 g/mol. IUPAC name: 5-amino-6-bromo-2-butylisoindole-1,3-dione. InChIKey: DAJBOBFEKRAZPE-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2O2 |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | 5-amino-6-bromo-2-butylisoindole-1,3-dione |
| InChIKey | DAJBOBFEKRAZPE-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=CC(=C(C=C2C1=O)Br)N |
Computed by PubChem (NCBI)