CAS 40571-56-0 is the registry number for rac-trans-2-Dimethylaminocyclohexanol Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
Trans-(1R,2R)-2-(dimethylamino)cyclohexan-1-ol;hydrochloride (CAS 40571-56-0) is a chemical compound with the molecular formula C8H18ClNO and a molecular weight of 179.69 g/mol. IUPAC name: trans-(1R,2R)-2-(dimethylamino)cyclohexan-1-ol;hydrochloride. InChIKey: AVQIJJSITJKGFM-SCLLHFNJSA-N.
| Molecular formula | C8H18ClNO |
|---|---|
| Molecular weight | 179.69 g/mol |
| IUPAC name | trans-(1R,2R)-2-(dimethylamino)cyclohexan-1-ol;hydrochloride |
| InChIKey | AVQIJJSITJKGFM-SCLLHFNJSA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1O.Cl |
Computed by PubChem (NCBI)