CAS 40580-83-4 appears in our catalog under these names: Harmol HCl, Harmol Hydrochloride, Harmol Hydrochloride, Harmol hydrochloride hydrate, 98.00%, Harmol hydrochloride monohydrate. Offered by: Chemat Brand, TRC, GLPBio, Chemat, Biosynth. Available pack sizes: on request, 2,5g, 100mg, 1g, 500mg, 5g, 10g, 25g.
1-methyl-2,9-dihydropyrido[3,4-b]indol-7-one;hydrochloride (CAS 40580-83-4) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 1-methyl-2,9-dihydropyrido[3,4-b]indol-7-one;hydrochloride. InChIKey: RBOUBJPHXSVUTH-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 1-methyl-2,9-dihydropyrido[3,4-b]indol-7-one;hydrochloride |
| InChIKey | RBOUBJPHXSVUTH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C3C=CC(=O)C=C3N2)C=CN1.Cl |
Computed by PubChem (NCBI)