Products 40594-37-4

CAS 40594-37-4 appears in our catalog under these names: (3,4-Difluorophenyl)hydrazine hydrochloride(1:x), 95%, 95%, (3,4-Difluorophenyl)hydrazine hydrochloride (1:x), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g.

Structural formula: {0} (CAS {1})

(3,4-difluorophenyl)hydrazine;hydrochloride (CAS 40594-37-4) is a chemical compound with the molecular formula C6H7ClF2N2 and a molecular weight of 180.58 g/mol. IUPAC name: (3,4-difluorophenyl)hydrazine;hydrochloride. InChIKey: QTEJTSFVIILHJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClF2N2
Molecular weight180.58 g/mol
IUPAC name(3,4-difluorophenyl)hydrazine;hydrochloride
InChIKeyQTEJTSFVIILHJJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1NN)F)F.Cl

Computed by PubChem (NCBI)