CAS 4073-74-9 is the registry number for Naphthalene-2,6-dicarbohydrazide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Naphthalene-2,6-dicarbohydrazide (CAS 4073-74-9) is a chemical compound with the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. IUPAC name: naphthalene-2,6-dicarbohydrazide. InChIKey: GNHGCDCAOUNOCA-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O2 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | naphthalene-2,6-dicarbohydrazide |
| InChIKey | GNHGCDCAOUNOCA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)NN)C=C1C(=O)NN |
Computed by PubChem (NCBI)