CAS 4074-63-9 is the registry number for 1-(4-(tert-Butoxy)phenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethanone (CAS 4074-63-9) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: 1-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethanone. InChIKey: GOYJWIRYQHFXDZ-UHFFFAOYSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 1-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethanone |
| InChIKey | GOYJWIRYQHFXDZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC(C)(C)C |
Computed by PubChem (NCBI)