CAS 40762-22-9 appears in our catalog under these names: D-Glucose-1-13C, >95% (HPLC), D-Glucose-13C-4, 98% 98%atom%13C, D–Glucose–1–13C, D-Glucose 1-13C, D-Glucose-1-13C. Offered by: TRC, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 500mg, 0,5g, 2g, 5g, 10g, 10mg.
(3R,4S,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol (CAS 40762-22-9) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (3R,4S,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-USBRANDWSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-USBRANDWSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([13CH](O1)O)O)O)O)O |
Computed by PubChem (NCBI)