Products 40776-40-7
CAS 40776-40-7 is the registry number for (+)-Frullanolide. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3aR)-5a,9-dimethyl-3-methylidene-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one (CAS 40776-40-7) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (3aR)-5a,9-dimethyl-3-methylidene-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one. InChIKey: PJPHIAMRKUNVSU-NUYPLMSZSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (3aR)-5a,9-dimethyl-3-methylidene-4,5,6,7,8,9b-hexahydro-3aH-benzo[g][1]benzofuran-2-one |
| InChIKey | PJPHIAMRKUNVSU-NUYPLMSZSA-N |
| SMILES | CC1=C2C3[C@H](CCC2(CCC1)C)C(=C)C(=O)O3 |
Computed by PubChem (NCBI)