Products 40784-88-1
CAS 40784-88-1 appears in our catalog under these names: Ethyl 4-ethoxyphenylacetate, 97%, Ethyl 2-(4-ethoxyphenyl)acetate, 95%, Ethyl 4–ethoxyphenylacetate, Ethyl 4-ethoxyphenylacetate, Ethyl 4-ethoxyphenylacetate, 97%(GC-MS),RG, 97%(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 25g, 5g, 1g, 1ml, 25ml, 5ml, 50g, 100g.
Ethyl 2-(4-ethoxyphenyl)acetate (CAS 40784-88-1) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: ethyl 2-(4-ethoxyphenyl)acetate. InChIKey: KZWVNVPYBUGYTA-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | ethyl 2-(4-ethoxyphenyl)acetate |
| InChIKey | KZWVNVPYBUGYTA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC(=O)OCC |
Computed by PubChem (NCBI)