Products 408314-44-3

CAS 408314-44-3 is the registry number for 4-Bromo-2,6-dichloro-3,5-dimethylphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-2,6-dichloro-3,5-dimethylphenol (CAS 408314-44-3) is a chemical compound with the molecular formula C8H7BrCl2O and a molecular weight of 269.95 g/mol. IUPAC name: 4-bromo-2,6-dichloro-3,5-dimethylphenol. InChIKey: UACAQSUBPQOHRP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrCl2O
Molecular weight269.95 g/mol
IUPAC name4-bromo-2,6-dichloro-3,5-dimethylphenol
InChIKeyUACAQSUBPQOHRP-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1Br)C)Cl)O)Cl

Computed by PubChem (NCBI)