CAS 408314-44-3 is the registry number for 4-Bromo-2,6-dichloro-3,5-dimethylphenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-2,6-dichloro-3,5-dimethylphenol (CAS 408314-44-3) is a chemical compound with the molecular formula C8H7BrCl2O and a molecular weight of 269.95 g/mol. IUPAC name: 4-bromo-2,6-dichloro-3,5-dimethylphenol. InChIKey: UACAQSUBPQOHRP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2O |
|---|---|
| Molecular weight | 269.95 g/mol |
| IUPAC name | 4-bromo-2,6-dichloro-3,5-dimethylphenol |
| InChIKey | UACAQSUBPQOHRP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)C)Cl)O)Cl |
Computed by PubChem (NCBI)