Products 408324-00-5
CAS 408324-00-5 is the registry number for 3,5-Dihydroxy-1-(3,4-dihydroxyphenyl)-7-(4-hydroxyphenyl)heptane. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3R,5R)-3,5-dihydroxy-7-(4-hydroxyphenyl)heptyl]benzene-1,2-diol (CAS 408324-00-5) is a chemical compound with the molecular formula C19H24O5 and a molecular weight of 332.4 g/mol. IUPAC name: 4-[(3R,5R)-3,5-dihydroxy-7-(4-hydroxyphenyl)heptyl]benzene-1,2-diol. InChIKey: XLTITIJKWVRJMS-IAGOWNOFSA-N.
| Molecular formula | C19H24O5 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 4-[(3R,5R)-3,5-dihydroxy-7-(4-hydroxyphenyl)heptyl]benzene-1,2-diol |
| InChIKey | XLTITIJKWVRJMS-IAGOWNOFSA-N |
| SMILES | C1=CC(=CC=C1CC[C@H](C[C@@H](CCC2=CC(=C(C=C2)O)O)O)O)O |
Computed by PubChem (NCBI)