Products 408324-13-0
CAS 408324-13-0 is the registry number for α-Synuclein inhibitor 14. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3R,5R)-3,5-dihydroxy-7-(4-hydroxy-3-methoxyphenyl)heptyl]benzene-1,2-diol (CAS 408324-13-0) is a chemical compound with the molecular formula C20H26O6 and a molecular weight of 362.4 g/mol. IUPAC name: 4-[(3R,5R)-3,5-dihydroxy-7-(4-hydroxy-3-methoxyphenyl)heptyl]benzene-1,2-diol. InChIKey: RIDWNCYOYKOUAC-HZPDHXFCSA-N.
| Molecular formula | C20H26O6 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 4-[(3R,5R)-3,5-dihydroxy-7-(4-hydroxy-3-methoxyphenyl)heptyl]benzene-1,2-diol |
| InChIKey | RIDWNCYOYKOUAC-HZPDHXFCSA-N |
| SMILES | COC1=C(C=CC(=C1)CC[C@H](C[C@@H](CCC2=CC(=C(C=C2)O)O)O)O)O |
Computed by PubChem (NCBI)