CAS 408336-09-4 is the registry number for 9-Methyl-9H-fluorene-2,7-diol. Offered by: TRC. Available pack sizes: 100mg.
9-methyl-9H-fluorene-2,7-diol (CAS 408336-09-4) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 9-methyl-9H-fluorene-2,7-diol. InChIKey: QOXQHDNHODRXMJ-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 9-methyl-9H-fluorene-2,7-diol |
| InChIKey | QOXQHDNHODRXMJ-UHFFFAOYSA-N |
| SMILES | CC1C2=C(C=CC(=C2)O)C3=C1C=C(C=C3)O |
Computed by PubChem (NCBI)