Products 408338-89-6
CAS 408338-89-6 is the registry number for 4-Methoxy-2-methyl-5-nitrobenzoic acid 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-methoxy-2-methyl-5-nitrobenzoic acid (CAS 408338-89-6) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 4-methoxy-2-methyl-5-nitrobenzoic acid. InChIKey: CBOCDPFTDSZWAL-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 4-methoxy-2-methyl-5-nitrobenzoic acid |
| InChIKey | CBOCDPFTDSZWAL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)