CAS 408352-90-9 is the registry number for (2-Phenyl-oxazol-4-yl)methylamine. Offered by: Biosynth. Available pack sizes: 10g, 1g.
(2-phenyl-1,3-oxazol-4-yl)methanamine (CAS 408352-90-9) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (2-phenyl-1,3-oxazol-4-yl)methanamine. InChIKey: NGYFPQIRGGHIHK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (2-phenyl-1,3-oxazol-4-yl)methanamine |
| InChIKey | NGYFPQIRGGHIHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)CN |
Computed by PubChem (NCBI)