CAS 40851-91-0 appears in our catalog under these names: 6-chloro-2-methoxy-3-nitropyridine 95%, 6-Chloro-2-methoxy-3-nitropyridine, 98%, 98%, 6-Chloro-2-methoxy-3-nitropyridine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g.
6-chloro-2-methoxy-3-nitropyridine (CAS 40851-91-0) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 6-chloro-2-methoxy-3-nitropyridine. InChIKey: OVVBXVJFGCFEFK-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 6-chloro-2-methoxy-3-nitropyridine |
| InChIKey | OVVBXVJFGCFEFK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)