CAS 4101-32-0 appears in our catalog under these names: 1–(4,5–Dimethoxy–2–nitrophenyl)ethanone, 3',4'-Dimethoxy-6'-nitroacetophenone, 4',5'-Dimethoxy-2'-nitroacetophenone, >98.0%(GC), 4',5'-Dimethoxy-2'-nitroacetophenone 95%, 4',5'-Dimethoxy-2'-nitroacetophenone, 95%, 95%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g.
1-(4,5-dimethoxy-2-nitrophenyl)ethanone (CAS 4101-32-0) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: 1-(4,5-dimethoxy-2-nitrophenyl)ethanone. InChIKey: ZVLFGESHYMKNQP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 1-(4,5-dimethoxy-2-nitrophenyl)ethanone |
| InChIKey | ZVLFGESHYMKNQP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1[N+](=O)[O-])OC)OC |
Computed by PubChem (NCBI)