CAS 41082-23-9 appears in our catalog under these names: 2-N-(2-Chlorophenyl)pyridine-2,3-diamine, 95%, 2-N-(2-Chlorophenyl)pyridine-2,3-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-N-(2-chlorophenyl)pyridine-2,3-diamine (CAS 41082-23-9) is a chemical compound with the molecular formula C11H10ClN3 and a molecular weight of 219.67 g/mol. IUPAC name: 2-N-(2-chlorophenyl)pyridine-2,3-diamine. InChIKey: UGNLSLORCFETTK-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 2-N-(2-chlorophenyl)pyridine-2,3-diamine |
| InChIKey | UGNLSLORCFETTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=C(C=CC=N2)N)Cl |
Computed by PubChem (NCBI)