CAS 41147-78-8 is the registry number for 1-ethyl-2-methyl-5-nitro-1H-imidazole. Offered by: Chemat Brand. Available pack sizes: on request.
1-ethyl-2-methyl-5-nitroimidazole (CAS 41147-78-8) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 1-ethyl-2-methyl-5-nitroimidazole. InChIKey: XYNVNGOLNUIHDV-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O2 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | 1-ethyl-2-methyl-5-nitroimidazole |
| InChIKey | XYNVNGOLNUIHDV-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC=C1[N+](=O)[O-])C |
Computed by PubChem (NCBI)