CAS 41198-02-1 appears in our catalog under these names: 2-Amino-3-bromo-5-chlorobenzoic Acid, 2-Amino-3-bromo-5-chlorobenzoic acid 95%, 2-Amino-3-bromo-5-chlorobenzoic acid, 98%, 98%, 2-Amino-3-bromo-5-chlorobenzoic acid, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100g, 10g, 50g.
2-amino-3-bromo-5-chlorobenzoic acid (CAS 41198-02-1) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 2-amino-3-bromo-5-chlorobenzoic acid. InChIKey: PWXLBVZWVKCFHR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 2-amino-3-bromo-5-chlorobenzoic acid |
| InChIKey | PWXLBVZWVKCFHR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Br)Cl |
Computed by PubChem (NCBI)