Products 41260-69-9
CAS 41260-69-9 is the registry number for N-(1-Chloro-2-oxo-2-phenylethyl)benzamide. Offered by: TRC. Available pack sizes: 25mg.
N-(1-chloro-2-oxo-2-phenylethyl)benzamide (CAS 41260-69-9) is a chemical compound with the molecular formula C15H12ClNO2 and a molecular weight of 273.71 g/mol. IUPAC name: N-(1-chloro-2-oxo-2-phenylethyl)benzamide. InChIKey: ZMANAHPLPILSDM-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO2 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | N-(1-chloro-2-oxo-2-phenylethyl)benzamide |
| InChIKey | ZMANAHPLPILSDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(NC(=O)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)