CAS 412925-12-3 appears in our catalog under these names: 3-Amino-3-(2,3-dimethylphenyl)propanoic acid, 3-Amino-3-(2,3-dimethylphenyl)propanoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 1g, 10g, 5g, 100mg.
3-amino-3-(2,3-dimethylphenyl)propanoic acid (CAS 412925-12-3) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 3-amino-3-(2,3-dimethylphenyl)propanoic acid. InChIKey: LFLCQYMIXBDOQL-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 3-amino-3-(2,3-dimethylphenyl)propanoic acid |
| InChIKey | LFLCQYMIXBDOQL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(CC(=O)O)N)C |
Computed by PubChem (NCBI)