Products 41295-62-9
CAS 41295-62-9 is the registry number for 1-(Chloromethyl)-3H-benzo(f)chromen-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
1-(chloromethyl)benzo[f]chromen-3-one (CAS 41295-62-9) is a chemical compound with the molecular formula C14H9ClO2 and a molecular weight of 244.67 g/mol. IUPAC name: 1-(chloromethyl)benzo[f]chromen-3-one. InChIKey: ZPGVCNAZYMUWKE-UHFFFAOYSA-N.
| Molecular formula | C14H9ClO2 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 1-(chloromethyl)benzo[f]chromen-3-one |
| InChIKey | ZPGVCNAZYMUWKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C(=CC(=O)O3)CCl |
Computed by PubChem (NCBI)