CAS 4132-24-5 is the registry number for 2,3,4-Tri-O-acetyl-1,6-anhydro-b-D-galactopyranose. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 10000mg, 5000mg.
[(2S,3S,4R,5R)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate (CAS 4132-24-5) is a chemical compound with the molecular formula C12H16O8 and a molecular weight of 288.25 g/mol. IUPAC name: [(2S,3S,4R,5R)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate. InChIKey: BAKQMOSGYGQJOJ-SHWDNJPRSA-N.
| Molecular formula | C12H16O8 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | [(2S,3S,4R,5R)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
| InChIKey | BAKQMOSGYGQJOJ-SHWDNJPRSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H]([C@@H]2OCC([C@@H]1OC(=O)C)O2)OC(=O)C |
Computed by PubChem (NCBI)