CAS 82756-28-3 appears in our catalog under these names: 3-O-beta-Galactosyl Isomaltol, β-D-Galactopyranosyl isomaltol, Galactosyl isomaltol. Offered by: TRC, Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 50mg, 25mg, 10mg.
1-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuran-2-yl]ethanone (CAS 82756-28-3) is a chemical compound with the molecular formula C12H16O8 and a molecular weight of 288.25 g/mol. IUPAC name: 1-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuran-2-yl]ethanone. InChIKey: RRYYNIJTMYUJDC-KZFLBEFCSA-N.
| Molecular formula | C12H16O8 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 1-[3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuran-2-yl]ethanone |
| InChIKey | RRYYNIJTMYUJDC-KZFLBEFCSA-N |
| SMILES | CC(=O)C1=C(C=CO1)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)