Products 52305-30-3
CAS 52305-30-3 appears in our catalog under these names: Resomer(R) LR 706 S, Poly(L-lactide-co-D, Resomer(R) LR 704 S, Poly(L-lactide-co-D, Resomer(R) LR 708, Poly(L-lactide-co-D,L, 3,6-Dimethyl-1,4-dioxane-2,5-dione polymer with (3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 25G, 1g, 5g.
3,6-dimethyl-1,4-dioxane-2,5-dione;(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione (CAS 52305-30-3) is a chemical compound with the molecular formula C12H16O8 and a molecular weight of 288.25 g/mol. IUPAC name: 3,6-dimethyl-1,4-dioxane-2,5-dione;(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione. InChIKey: JFPPGQABHIMQKV-MMALYQPHSA-N.
| Molecular formula | C12H16O8 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 3,6-dimethyl-1,4-dioxane-2,5-dione;(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione |
| InChIKey | JFPPGQABHIMQKV-MMALYQPHSA-N |
| SMILES | C[C@H]1C(=O)O[C@H](C(=O)O1)C.CC1C(=O)OC(C(=O)O1)C |
Computed by PubChem (NCBI)