Products 4132-38-1
CAS 4132-38-1 appears in our catalog under these names: 4-O-Methyl-D-glucose, (2R,3R,4R,5R)–2,3,5,6–tetrahydroxy–4–methoxyhexanal, 4-O-Methyl-D-glucose, 97.00%. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 50mg, 100mg, 25mg, 10mg, 5mg, 250mg.
(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-methoxyhexanal (CAS 4132-38-1) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-methoxyhexanal. InChIKey: GQYKSISLCPUNJT-BDVNFPICSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-methoxyhexanal |
| InChIKey | GQYKSISLCPUNJT-BDVNFPICSA-N |
| SMILES | CO[C@H]([C@@H](CO)O)[C@@H]([C@H](C=O)O)O |
Computed by PubChem (NCBI)