CAS 41340-19-6 appears in our catalog under these names: Etodolac EP Impurity B, Etodolac Impurity 2 (Etodolac EP Impurity B), 8-Methyl Etodolac, >95% (HPLC), 2-((1RS)-1-Ethyl-8-methyl-1,3,4,9-tetrahydropyrano(3,4-b)indol-1-yl)acetic Acid (8-Methyl Etodolac), 8-Methyl etodolac. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(1-ethyl-8-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid (CAS 41340-19-6) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: 2-(1-ethyl-8-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid. InChIKey: MXFIBWNLCQBCCN-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 2-(1-ethyl-8-methyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)acetic acid |
| InChIKey | MXFIBWNLCQBCCN-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(CCO1)C3=CC=CC(=C3N2)C)CC(=O)O |
Computed by PubChem (NCBI)