Products 413582-76-0

CAS 413582-76-0 is the registry number for 4-([(2,5-Dichlorophenyl)thio]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-[(2,5-dichlorophenyl)sulfanylmethyl]benzoic acid (CAS 413582-76-0) is a chemical compound with the molecular formula C14H10Cl2O2S and a molecular weight of 313.2 g/mol. IUPAC name: 4-[(2,5-dichlorophenyl)sulfanylmethyl]benzoic acid. InChIKey: YMBRGRZBAQOBPC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10Cl2O2S
Molecular weight313.2 g/mol
IUPAC name4-[(2,5-dichlorophenyl)sulfanylmethyl]benzoic acid
InChIKeyYMBRGRZBAQOBPC-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CSC2=C(C=CC(=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)