CAS 54842-65-8 appears in our catalog under these names: 2-((2,5-Dichlorophenyl)sulfanyl)-2-phenylacetic acid, 95%, 2-((2,5-Dichlorophenyl)sulfanyl)-2-phenylacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(2,5-dichlorophenyl)sulfanyl-2-phenylacetic acid (CAS 54842-65-8) is a chemical compound with the molecular formula C14H10Cl2O2S and a molecular weight of 313.2 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)sulfanyl-2-phenylacetic acid. InChIKey: IEHILMPEHGMAEC-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2S |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)sulfanyl-2-phenylacetic acid |
| InChIKey | IEHILMPEHGMAEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)SC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)