CAS 938263-34-4 appears in our catalog under these names: 3-{((3,5-dichlorophenyl)sulfanyl)methyl}benzoic acid, 95%, 3-{((3,5-Dichlorophenyl)sulfanyl)methyl}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-[(3,5-dichlorophenyl)sulfanylmethyl]benzoic acid (CAS 938263-34-4) is a chemical compound with the molecular formula C14H10Cl2O2S and a molecular weight of 313.2 g/mol. IUPAC name: 3-[(3,5-dichlorophenyl)sulfanylmethyl]benzoic acid. InChIKey: LILGNWTYJZBYGI-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2S |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | 3-[(3,5-dichlorophenyl)sulfanylmethyl]benzoic acid |
| InChIKey | LILGNWTYJZBYGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CSC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)