Products 4144-62-1
CAS 4144-62-1 appears in our catalog under these names: 5-Benzoylpentanoic acid, 95%, 5-Benzoylpentanoic acid, 99% , 5-Benzoylpentanoic acid, 5-Benzoylpentanoic Acid, >98.0%(GC)(T), 6-Oxo-6-phenylhexanoic acid 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg.
6-oxo-6-phenylhexanoic acid (CAS 4144-62-1) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 6-oxo-6-phenylhexanoic acid. InChIKey: AIEMSTCGCMIJTI-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 6-oxo-6-phenylhexanoic acid |
| InChIKey | AIEMSTCGCMIJTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)