CAS 4144-65-4 is the registry number for 2-Benzotriazol-1-yl-propionic acid. Offered by: TRC. Available pack sizes: 100mg.
2-(benzotriazol-1-yl)propanoic acid (CAS 4144-65-4) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-(benzotriazol-1-yl)propanoic acid. InChIKey: MCHYXZGLOIXABY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-(benzotriazol-1-yl)propanoic acid |
| InChIKey | MCHYXZGLOIXABY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)