CAS 41498-06-0 appears in our catalog under these names: 5-Bromo-1-naphthaldehyde, 98%, 5-Bromo-1-naphthaldehyde, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-bromonaphthalene-1-carbaldehyde (CAS 41498-06-0) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 5-bromonaphthalene-1-carbaldehyde. InChIKey: RFBLXLCJCJMOCN-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 5-bromonaphthalene-1-carbaldehyde |
| InChIKey | RFBLXLCJCJMOCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=C(C2=C1)Br)C=O |
Computed by PubChem (NCBI)